857283-95-5 Usage
Uses
Used in Pharmaceutical Industry:
4-[4-(BROMOMETHYL)PHENYL]-2-METHYL-1,3-THIAZOLE is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs and therapeutic agents. Its unique structural and electronic properties allow for the creation of molecules with specific biological activities, enhancing the efficacy and safety of medications.
Used in Agrochemical Industry:
In the agrochemical industry, 4-[4-(BROMOMETHYL)PHENYL]-2-METHYL-1,3-THIAZOLE is utilized as a building block in the development of new agrochemicals. Its properties can be leveraged to create compounds with targeted effects on pests or diseases, improving crop protection and yield.
Used in Material Science:
4-[4-(BROMOMETHYL)PHENYL]-2-METHYL-1,3-THIAZOLE is employed as a component in the development of new materials in material science. Its unique properties can be integrated into materials to achieve specific characteristics, such as improved conductivity, stability, or reactivity, depending on the application.
Used in Organic Compounds Synthesis:
As a thiazole derivative, 4-[4-(BROMOMETHYL)PHENYL]-2-METHYL-1,3-THIAZOLE is used as a key component in the synthesis of various organic compounds. Its presence in these compounds can impart new functionalities or enhance existing ones, broadening the scope of organic chemistry and its applications.
Check Digit Verification of cas no
The CAS Registry Mumber 857283-95-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,7,2,8 and 3 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 857283-95:
(8*8)+(7*5)+(6*7)+(5*2)+(4*8)+(3*3)+(2*9)+(1*5)=215
215 % 10 = 5
So 857283-95-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H10BrNS/c1-8-13-11(7-14-8)10-4-2-9(6-12)3-5-10/h2-5,7H,6H2,1H3
