857284-07-2 Usage
Uses
Used in Pharmaceutical Synthesis:
[3-(2-MORPHOLINOETHOXY)PHENYL]METHANOL is used as a building block in the synthesis of pharmaceuticals for its potential pharmacological properties. It contributes to the development of new drugs by providing a versatile chemical structure that can be modified for specific therapeutic applications.
Used in Agrochemical Development:
In the agrochemical industry, [3-(2-MORPHOLINOETHOXY)PHENYL]METHANOL is used as a precursor in the synthesis of various agrochemicals. Its unique structure allows for the creation of compounds that can be utilized in pest control, crop protection, and other agricultural applications.
Used in Materials Science:
[3-(2-MORPHOLINOETHOXY)PHENYL]METHANOL is employed in materials science as a component in the development of new materials with specific properties. Its incorporation into material formulations can lead to advancements in areas such as polymer science, composite materials, and other specialized material applications.
Used as a Reagent in Organic Chemistry:
[3-(2-MORPHOLINOETHOXY)PHENYL]METHANOL is used as a reagent in organic chemistry reactions, particularly in the formation of esters and ethers. Its functional groups facilitate various reaction pathways, making it a useful tool for chemists in the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 857284-07-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,7,2,8 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 857284-07:
(8*8)+(7*5)+(6*7)+(5*2)+(4*8)+(3*4)+(2*0)+(1*7)=202
202 % 10 = 2
So 857284-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO3/c15-11-12-2-1-3-13(10-12)17-9-6-14-4-7-16-8-5-14/h1-3,10,15H,4-9,11H2
857284-07-2Relevant academic research and scientific papers
Compounds for the treatment of ischemia
-
Page 59, (2010/02/08)
A3 agonists, methods of using such A3 agonists and pharmaceutical compositions containing such A3 agonists. The A3 agonists are useful for the reduction of tissue damage resulting from tissue ischemia or hypoxia
