85760-92-5 Usage
Uses
Used in Pharmaceutical Research and Development:
(S)-1-benzoyl-N,N-diethyl-5-oxopyrrolidine-2-carboxamide is used as a building block in the synthesis of various organic compounds for pharmaceutical research and development. Its unique molecular structure, which includes a benzoyl group, a diethylcarbamoyl group, and a 5-oxopyrrolidine-2-carboxamide group, provides potential for various pharmacological applications.
Used in Drug Design:
In the field of drug design, (S)-1-benzoyl-N,N-diethyl-5-oxopyrrolidine-2-carboxamide is used as a structural component to create new drugs with potential therapeutic effects. Its molecular structure allows for the development of compounds that can interact with specific biological targets, potentially leading to the creation of novel medications.
Used in Medicinal Chemistry:
(S)-1-benzoyl-N,N-diethyl-5-oxopyrrolidine-2-carboxamide is also utilized in medicinal chemistry as a compound with potential biological activity. Its chemical properties and structure make it a valuable tool for understanding and manipulating the interactions between drugs and their targets, which can ultimately contribute to the development of more effective treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 85760-92-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,7,6 and 0 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 85760-92:
(7*8)+(6*5)+(5*7)+(4*6)+(3*0)+(2*9)+(1*2)=165
165 % 10 = 5
So 85760-92-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H20N2O3/c1-3-17(4-2)16(21)13-10-11-14(19)18(13)15(20)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3/t13-/m0/s1