858227-12-0 Usage
Description
6-Methyl-3-(1H)indazole carboxylic acid is a chemical compound with the molecular formula C10H9N2O2, belonging to the indazole family of bicyclic aromatic compounds. It features a carboxylic acid functional group, which endows it with reactivity and potential for use in the synthesis of pharmaceuticals and drug-like molecules. 6-METHYL-3-(1H)INDAZOLE CARBOXYLIC ACID is also of interest in medical research due to its possible pharmacological properties and biological activities.
Uses
Used in Pharmaceutical Industry:
6-Methyl-3-(1H)indazole carboxylic acid is used as a building block for the development of various drugs and drug-like molecules. Its carboxylic acid functional group facilitates the synthesis of new compounds through chemical reactions, contributing to the creation of innovative pharmaceutical agents.
Used in Drug Discovery:
6-Methyl-3-(1H)indazole carboxylic acid is studied for its potential pharmacological properties, as it may possess biological activities that could be beneficial for medical research. Its exploration in drug discovery aims to identify and harness these properties for therapeutic applications.
Used in Chemical Synthesis:
In the field of chemical synthesis, 6-Methyl-3-(1H)indazole carboxylic acid is utilized as a key intermediate for the preparation of a variety of organic compounds. Its reactivity and structural features make it a valuable component in the synthesis of complex molecules with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 858227-12-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,8,2,2 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 858227-12:
(8*8)+(7*5)+(6*8)+(5*2)+(4*2)+(3*7)+(2*1)+(1*2)=190
190 % 10 = 0
So 858227-12-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O2/c1-5-2-3-6-7(4-5)10-11-8(6)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13)
