858279-19-3 Usage
Uses
Used in Pharmaceutical Industry:
Quinoline, 3-chloro-7-methoxyis used as an intermediate in the synthesis of various pharmaceuticals. Its unique structure and properties make it a valuable building block for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
Quinoline, 3-chloro-7-methoxyis also used in the production of agrochemicals, such as pesticides and herbicides. Its biological activity and chemical properties contribute to the effectiveness of these products in controlling pests and weeds in agricultural settings.
Used in Dye Industry:
Quinoline, 3-chloro-7-methoxyis utilized in the dye industry for the production of various dyes. Its aromatic structure and functional groups allow for the creation of dyes with specific color properties and stability.
Used in Antimalarial Applications:
Quinoline, 3-chloro-7-methoxyhas been studied for its potential use as an antimalarial agent. Its biological activity against the Plasmodium parasite, which causes malaria, makes it a promising candidate for the development of new antimalarial drugs.
Used in Antibacterial Applications:
Quinoline, 3-chloro-7-methoxyhas also been investigated for its potential antibacterial properties. Its ability to inhibit the growth of bacteria makes it a candidate for the development of new antibiotics to combat bacterial infections.
Used in Organic Synthesis:
Quinoline, 3-chloro-7-methoxyplays a role in organic synthesis as a building block for the preparation of other chemical compounds. Its unique structure and functional groups make it a versatile starting material for the synthesis of various organic molecules with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 858279-19-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,8,2,7 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 858279-19:
(8*8)+(7*5)+(6*8)+(5*2)+(4*7)+(3*9)+(2*1)+(1*9)=223
223 % 10 = 3
So 858279-19-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H8ClNO/c1-13-9-3-2-7-4-8(11)6-12-10(7)5-9/h2-6H,1H3
