85851-53-2 Usage
Molecular structure
2-[[5-(acetylamino)-4-[(2-bromo-4,6-dinitrophenyl)azo]-2-ethoxyphenyl][2-[(chloroacetyl)oxy]ethyl]amino]ethyl butyrate is a complex organic compound with multiple functional groups attached to a central ethoxyphenyl group.
Functional groups
The compound contains several functional groups, including an acetylamino group, a chloroacetyl group, a bromo-dinitrophenylazo moiety, and an ethyl butyrate chain.
Bromo-dinitrophenylazo moiety
This functional group consists of a bromo (Br) atom and two nitro (NO2) groups attached to a phenyl ring, which is further connected to an azo (N=N) group. This moiety may exhibit potential reactivity and hazardous properties.
Acetylamino group
An amide functional group (-CONH2) derived from acetic acid, which can participate in various chemical reactions and hydrogen bonding.
Chloroacetyl group
A halogenated acetyl group (-CClO2H) that can undergo nucleophilic substitution reactions due to the presence of the chlorine atom.
Ethoxyphenyl group
A phenyl ring attached to an ethoxy (OEt) group, which can influence the compound's solubility and reactivity.
Ethyl butyrate chain
A long alkyl chain (-CH2CH2CH2COOEt) derived from butyric acid, which can contribute to the compound's lipophilicity and stability.
Potential applications
The compound has potential uses in various industries, such as pharmaceuticals, dyes, and organic chemistry research, due to its diverse functional groups and potential for chemical reactivity.
Hazardous groups
The presence of potentially hazardous groups, such as the bromo and nitro groups, requires careful handling and storage to avoid accidents and environmental contamination.
Chemical reactivity
The compound's multiple functional groups and complex structure may lead to various chemical reactions, making it a valuable subject for research and development in organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 85851-53-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,8,5 and 1 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 85851-53:
(7*8)+(6*5)+(5*8)+(4*5)+(3*1)+(2*5)+(1*3)=162
162 % 10 = 2
So 85851-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C26H30BrClN6O10/c1-4-6-24(36)43-9-7-32(8-10-44-25(37)15-28)21-13-19(29-16(3)35)20(14-23(21)42-5-2)30-31-26-18(27)11-17(33(38)39)12-22(26)34(40)41/h11-14H,4-10,15H2,1-3H3,(H,29,35)/b31-30+