85851-62-3 Usage
General Description
1-Acetylhexahydro-1H-azepinium methyl sulphate is a chemical compound that is commonly used as a chiral resolving agent in organic synthesis. It is a quaternary ammonium salt, and its unique structure allows it to efficiently separate enantiomers, which are molecules that are mirror images of each other. 1-Acetylhexahydro-1H-azepinium methyl sulphate has a high affinity for binding to specific enantiomers, allowing for their selective separation and purification. It is also used in the preparation of various pharmaceuticals and fine chemicals. Additionally, it has been studied for its potential applications in catalysis and asymmetric synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 85851-62-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,8,5 and 1 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 85851-62:
(7*8)+(6*5)+(5*8)+(4*5)+(3*1)+(2*6)+(1*2)=163
163 % 10 = 3
So 85851-62-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO.CH4O4S/c1-8(10)9-6-4-2-3-5-7-9;1-5-6(2,3)4/h2-7H2,1H3;1H3,(H,2,3,4)