858956-25-9 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
2-Cyclopropyl-6-oxo-1,6-dihydro-pyrimidine-4-carboxylic acid serves as a crucial building block in the synthesis of various pharmaceuticals and agrochemicals. Its versatile chemical structure allows for the development of new compounds with potential therapeutic and pesticidal properties.
Used in Medicinal Research:
In the realm of medicinal research, 2-cyclopropyl-6-oxo-1,6-dihydro-pyrimidine-4-carboxylic acid has been studied for its potential therapeutic applications. It has shown promise as an antiviral and antitumor agent, making it a significant candidate for further investigation and development in the medical field.
Used in Chemical Research:
The unique reactivity of the cyclopropyl group in 2-cyclopropyl-6-oxo-1,6-dihydro-pyrimidine-4-carboxylic acid makes it a valuable tool for chemical research. It can be utilized to explore novel chemical reactions and mechanisms, contributing to the advancement of synthetic chemistry and the discovery of new chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 858956-25-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,8,9,5 and 6 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 858956-25:
(8*8)+(7*5)+(6*8)+(5*9)+(4*5)+(3*6)+(2*2)+(1*5)=239
239 % 10 = 9
So 858956-25-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2O3/c11-6-3-5(8(12)13)9-7(10-6)4-1-2-4/h3-4H,1-2H2,(H,12,13)(H,9,10,11)
