859166-87-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Pyridinemethanamine, 4-Fluorois used as a key intermediate in the synthesis of various pharmaceuticals. Its presence in the molecular structure can enhance the biological activity and selectivity of the final drug molecules. It is particularly useful in the development of drugs targeting central nervous system disorders, cardiovascular diseases, and oncology.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Pyridinemethanamine, 4-Fluoroserves as a crucial building block for the synthesis of various agrochemicals, including herbicides, insecticides, and fungicides. Its unique structure and reactivity contribute to the development of novel and effective agrochemicals with improved selectivity and reduced environmental impact.
Used in Organic Synthesis:
2-Pyridinemethanamine, 4-Fluorois also employed as a versatile reagent in organic synthesis. Its ability to participate in various chemical reactions, such as nucleophilic substitution, electrophilic substitution, and reductive amination, makes it a valuable component in the synthesis of complex organic molecules and functional materials.
Safety Precautions:
Due to its potential hazards, it is essential to handle 2-Pyridinemethanamine, 4-Fluorowith care and follow proper safety precautions. This includes wearing appropriate personal protective equipment, working in a well-ventilated area, and disposing of the chemical waste responsibly. Additionally, it is crucial to store 2-PYRIDINEMETHANAMINE, 4-FLUORO- away from heat, sparks, and open flames to prevent any accidents or explosions.
Check Digit Verification of cas no
The CAS Registry Mumber 859166-87-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,9,1,6 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 859166-87:
(8*8)+(7*5)+(6*9)+(5*1)+(4*6)+(3*6)+(2*8)+(1*7)=223
223 % 10 = 3
So 859166-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H7FN2/c7-5-1-2-9-6(3-5)4-8/h1-3H,4,8H2
