859850-86-5 Usage
Description
(3-THIEN-2-YLPHENYL)METHYLAMINE, with the molecular formula C10H11NS, is a colorless to pale yellow liquid amine derivative of thienylphenylethylamine. It features a thienyl group attached to a phenyl ring, with a methylamine substituent, and has a molecular weight of 177.27 g/mol. This unique structure and properties make it a promising intermediate for various applications in the synthesis of pharmaceuticals and agrochemicals, as well as in organic synthesis and medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
(3-THIEN-2-YLPHENYL)METHYLAMINE is used as an intermediate for the synthesis of pharmaceuticals due to its unique structure and properties, which can contribute to the development of new drugs with potential therapeutic effects.
Used in Agrochemical Industry:
(3-THIEN-2-YLPHENYL)METHYLAMINE is used as an intermediate for the synthesis of agrochemicals, potentially leading to the creation of new compounds with applications in agriculture, such as pesticides or herbicides.
Used in Organic Synthesis:
(3-THIEN-2-YLPHENYL)METHYLAMINE is used as a building block in organic synthesis, allowing for the creation of various organic compounds with diverse applications.
Used in Medicinal Chemistry:
(3-THIEN-2-YLPHENYL)METHYLAMINE is used in medicinal chemistry for the development of new compounds with potential therapeutic properties, given its unique structure and reactivity.
Note: The exact uses and potential effects of (3-THIEN-2-YLPHENYL)METHYLAMINE have not been extensively studied, and further research may be necessary to fully understand its potential applications and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 859850-86-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,9,8,5 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 859850-86:
(8*8)+(7*5)+(6*9)+(5*8)+(4*5)+(3*0)+(2*8)+(1*6)=235
235 % 10 = 5
So 859850-86-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NS/c12-8-9-3-1-4-10(7-9)11-5-2-6-13-11/h1-7H,8,12H2
