860195-69-3 Usage
Uses
Used in Pharmaceutical Industry:
6-Bromo-4-chloro-2-phenylquinoline is used as a key intermediate in the synthesis of pharmaceutical compounds for its ability to contribute to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
6-BROMO-4-CHLORO-2-PHENYLQUINOLINE is utilized as an intermediate in the production of agrochemicals, playing a crucial role in the development of pesticides and other agricultural chemicals to improve crop protection and yield.
Used in Biological Research:
6-Bromo-4-chloro-2-phenylquinoline is employed as a fluorescent probe for detecting metal ions, which aids researchers in understanding the interactions between metal ions and various biological systems.
Used in Anti-Inflammatory and Antimicrobial Applications:
Due to its potential biological activities, 6-bromo-4-chloro-2-phenylquinoline is studied for use as an anti-inflammatory and antimicrobial agent, which could contribute to the development of new treatments for various inflammatory and infectious diseases.
Used in Chemical Industry:
As a versatile building block, 6-bromo-4-chloro-2-phenylquinoline is used in the chemical industry for the production of various functional molecules, contributing to the advancement of chemical research and the creation of novel compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 860195-69-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,0,1,9 and 5 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 860195-69:
(8*8)+(7*6)+(6*0)+(5*1)+(4*9)+(3*5)+(2*6)+(1*9)=183
183 % 10 = 3
So 860195-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H9BrClN/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-9H
