860296-12-4 Usage
Uses
Used in Pharmaceutical Industry:
3-Fluoro-5-hydroxybenzoic acid is used as an intermediate in the synthesis of various pharmaceuticals for its reactivity and versatility in chemical reactions. It contributes to the development of new drugs with improved therapeutic properties and efficacy.
Used in Agrochemical Industry:
In the agrochemical industry, 3-Fluoro-5-hydroxybenzoic acid serves as a key intermediate in the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds enhances their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Dye Industry:
3-Fluoro-5-hydroxybenzoic acid is utilized as a building block in the synthesis of various dyes due to its chemical properties. It plays a crucial role in the development of new dyes with unique color characteristics and improved performance in various applications, such as textiles, plastics, and printing inks.
Used in Antimicrobial and Antifungal Applications:
3-Fluoro-5-hydroxybenzoic acid is known for its potential antimicrobial and antifungal properties, making it a subject of interest in the development of new drugs. It can be used as an active ingredient in antimicrobial and antifungal formulations, offering effective solutions against various microbial infections and fungal diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 860296-12-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,0,2,9 and 6 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 860296-12:
(8*8)+(7*6)+(6*0)+(5*2)+(4*9)+(3*6)+(2*1)+(1*2)=174
174 % 10 = 4
So 860296-12-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5FO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9H,(H,10,11)
