860496-20-4 Usage
Description
1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid is a heterocyclic compound characterized by a unique fused pyrrole and pyridine ring system. As a carboxylic acid derivative, it features a carboxyl group (-COOH) attached to the carbon in position 3 of the pyridine ring. 1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid is recognized for its potential applications in the pharmaceutical industry and as a versatile building block in organic synthesis for creating a variety of chemical substances. Its distinctive structure and properties render it an important intermediate in the synthesis of complex organic molecules.
Uses
Used in Pharmaceutical Industry:
1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid is utilized as a key intermediate in the development of new drugs and medicinal compounds, leveraging its unique chemical structure to enhance the therapeutic potential of pharmaceutical formulations.
Used in Organic Synthesis:
In the field of organic synthesis, 1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid serves as a building block for the production of various chemical substances. Its incorporation into synthetic pathways allows for the creation of a wide array of complex organic molecules, contributing to the advancement of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 860496-20-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,0,4,9 and 6 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 860496-20:
(8*8)+(7*6)+(6*0)+(5*4)+(4*9)+(3*6)+(2*2)+(1*0)=184
184 % 10 = 4
So 860496-20-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O2/c11-8(12)5-4-10-6-2-1-3-9-7(5)6/h1-4,10H,(H,11,12)
