86120-56-1 Usage
Properties of 20-oxopregnacalciferol
1. Synthetic vitamin D analog
2. Derivative of vitamin D
3. Exhibits potent anti-proliferative properties
4. Exhibits pro-differentiation properties
5. Modulates immune function
6. Modulates inflammation
Specific content about 20-oxopregnacalciferol
1. Studied for its potential therapeutic applications in various medical conditions
2. Potent anti-proliferative effects on cancer cells
3. Pro-differentiation effects on cancer cells
4. Modulates immune function
5. Modulates inflammation
6. Potential candidate for the treatment of autoimmune diseases
7. Potential candidate for the treatment of other immune-related disorders
8. Ongoing research on 20-oxopregnacalciferol
9. Holds promise for the development of novel therapeutic approaches in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 86120-56-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,1,2 and 0 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 86120-56:
(7*8)+(6*6)+(5*1)+(4*2)+(3*0)+(2*5)+(1*6)=121
121 % 10 = 1
So 86120-56-1 is a valid CAS Registry Number.
InChI:InChI=1/C21H30O2/c1-14-6-9-18(23)13-17(14)8-7-16-5-4-12-21(3)19(15(2)22)10-11-20(16)21/h7-8,18-20,23H,1,4-6,9-13H2,2-3H3/b16-7+,17-8-/t18-,19+,20+,21-/m0/s1
86120-56-1Relevant articles and documents
20-Oxopregnacalciferols: Vitamin D compounds that bind the progesterone receptor
Perlman, Kato L.,Darwish, Hisham M.,Deluca, Hector F.
, p. 2295 - 2298 (1994)
20-Oxopregnacalciferols and 19-nor-20-oxopregnacalciferol were prepared from calciferol 22-aldehydes by an oxygenation procedure.