86153-25-5 Usage
General Description
7-Bromo-1H-indole-3-carboxylic acid is a chemical compound with the molecular formula C9H6BrNO2. It is a derivative of indole, which is a heterocyclic organic compound. The presence of a bromine atom and a carboxylic acid group in its molecular structure gives 7-Bromo-1H-indole-3-carboxylic acid both halogen and acidic properties. 7-BROMO-1H-INDOLE-3-CARBOXYLIC ACID has potential applications in pharmaceutical and agricultural industries, specifically in the synthesis of various organic compounds and as a raw material for the production of agrochemicals and pharmaceuticals. Additionally, it may also have uses in organic synthesis and research fields due to its unique structural properties.
Check Digit Verification of cas no
The CAS Registry Mumber 86153-25-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,1,5 and 3 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 86153-25:
(7*8)+(6*6)+(5*1)+(4*5)+(3*3)+(2*2)+(1*5)=135
135 % 10 = 5
So 86153-25-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H6BrNO2/c10-7-3-1-2-5-6(9(12)13)4-11-8(5)7/h1-4,11H,(H,12,13)