86153-25-5 Usage
Uses
Used in Pharmaceutical Industry:
7-BROMO-1H-INDOLE-3-CARBOXYLIC ACID is used as a raw material for the production of pharmaceuticals due to its potential role in the synthesis of various organic compounds. Its unique structural properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Agricultural Industry:
7-BROMO-1H-INDOLE-3-CARBOXYLIC ACID is used as a raw material for the production of agrochemicals, specifically in the synthesis of various organic compounds that can be utilized in the development of pesticides, herbicides, and other agricultural chemicals. Its halogen and acidic properties contribute to its effectiveness in these applications.
Used in Organic Synthesis:
7-BROMO-1H-INDOLE-3-CARBOXYLIC ACID is used as a key intermediate in organic synthesis, allowing for the creation of a wide range of chemical compounds. Its unique structural properties make it a valuable building block in the synthesis of complex organic molecules.
Used in Research Fields:
7-BROMO-1H-INDOLE-3-CARBOXYLIC ACID is used as a research compound in various scientific fields, including chemistry, biology, and materials science. Its unique structural properties make it an interesting subject for study, potentially leading to new discoveries and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 86153-25-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,1,5 and 3 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 86153-25:
(7*8)+(6*6)+(5*1)+(4*5)+(3*3)+(2*2)+(1*5)=135
135 % 10 = 5
So 86153-25-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H6BrNO2/c10-7-3-1-2-5-6(9(12)13)4-11-8(5)7/h1-4,11H,(H,12,13)
