861905-97-7 Usage
Uses
Used in Organic Synthesis:
2-METHYL-4-PYRIDINEBORIC ACID HCL is used as a catalyst for its ability to effectively facilitate a range of reactions, enhancing the efficiency and selectivity of organic synthesis processes.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-METHYL-4-PYRIDINEBORIC ACID HCL is utilized as a reagent, playing a crucial role in the development of new drug compounds by enabling specific chemical transformations necessary for the synthesis of potential medicinal agents.
Used in Electronic Materials Manufacturing:
2-METHYL-4-PYRIDINEBORIC ACID HCL is also used in the production of electronic materials due to its unique properties and reactivity, which contribute to the advancement of technology in this sector.
Check Digit Verification of cas no
The CAS Registry Mumber 861905-97-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,1,9,0 and 5 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 861905-97:
(8*8)+(7*6)+(6*1)+(5*9)+(4*0)+(3*5)+(2*9)+(1*7)=197
197 % 10 = 7
So 861905-97-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H8BNO3/c1-5-4-6(2-3-8-5)11-7(9)10/h2-4,9-10H,1H3
