86199-24-8 Usage
Molecular structure
A complex structure containing a thiocyanatomethyl group, a tetrahydroisoindole ring, and a dione functional group.
Thiocyanatomethyl group
A group containing a sulfur atom bonded to a cyanide group (CN). This group may contribute to the compound's reactivity and potential applications.
Tetrahydroisoindole ring
A ring structure consisting of four carbon atoms and two hydrogen atoms, derived from the isoindole core. This ring system may influence the compound's stability and chemical properties.
Dione functional group
A functional group containing two carbonyl groups (C=O) separated by a single carbon atom. This group may contribute to the compound's reactivity and potential applications in organic synthesis.
Potential applications
The compound may have potential uses in organic synthesis, pharmaceuticals, or materials science due to its unique structure and reactivity.
Further research
Additional research and experimentation may be necessary to fully understand the potential uses and effects of 2-(thiocyanatomethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
Check Digit Verification of cas no
The CAS Registry Mumber 86199-24-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,1,9 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 86199-24:
(7*8)+(6*6)+(5*1)+(4*9)+(3*9)+(2*2)+(1*4)=168
168 % 10 = 8
So 86199-24-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O2S/c11-5-15-6-12-9(13)7-3-1-2-4-8(7)10(12)14/h1-2,7-8H,3-4,6H2
