864068-93-9 Usage
Uses
Used in Organic Synthesis:
1-(4-IODOBENZYL)-1H-1,2,4-TRIAZOLE is used as a building block for the synthesis of diverse functionalized molecules, contributing to the development of pharmaceuticals, pesticides, and other industrial products. Its unique structure and reactivity facilitate the preparation of complex organic compounds with potential applications in various sectors.
Used in Coordination Chemistry:
In coordination chemistry, 1-(4-IODOBENZYL)-1H-1,2,4-TRIAZOLE serves as a ligand, playing a crucial role in the formation of coordination compounds. Its ability to chelate with metal ions allows for the creation of stable complexes with specific properties, which can be utilized in various applications, including catalysis and materials science.
Used in Medicinal Chemistry:
1-(4-IODOBENZYL)-1H-1,2,4-TRIAZOLE is used as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its unique structure and reactivity enable the development of new drugs with potential therapeutic applications in various medical fields.
Used in Agrochemicals:
In the agrochemical industry, 1-(4-IODOBENZYL)-1H-1,2,4-TRIAZOLE is used for the synthesis of pesticides and other agrochemical products. Its potential applications in this field include the development of new pesticides with improved efficacy and selectivity, contributing to more sustainable agricultural practices.
Used in Materials Science:
1-(4-IODOBENZYL)-1H-1,2,4-TRIAZOLE is utilized in the development of new materials with specific properties, such as conductivity, magnetism, or optical properties. Its unique structure and reactivity make it a promising candidate for the synthesis of advanced materials for various applications, including electronics, sensors, and energy storage devices.
Check Digit Verification of cas no
The CAS Registry Mumber 864068-93-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,4,0,6 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 864068-93:
(8*8)+(7*6)+(6*4)+(5*0)+(4*6)+(3*8)+(2*9)+(1*3)=199
199 % 10 = 9
So 864068-93-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H8IN3/c10-9-3-1-8(2-4-9)5-13-7-11-6-12-13/h1-4,6-7H,5H2
