864068-93-9 Usage
General Description
1-(4-Iodobenzyl)-1H-1,2,4-triazole is a chemical compound that belongs to the triazole group and contains an iodine atom attached to a benzyl group. It is commonly used as a building block in organic synthesis and as a ligand in coordination chemistry. 1-(4-IODOBENZYL)-1H-1,2,4-TRIAZOLE has been studied for its potential applications in various fields, including medicinal chemistry, agrochemicals, and materials science. Its unique structure and reactivity make it a versatile tool for the preparation of diverse functionalized molecules with potential applications in pharmaceuticals, pesticides, and other industrial sectors. Additionally, its triazole scaffold and organic functional groups render it as an interesting molecule for further investigation and development of new chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 864068-93-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,4,0,6 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 864068-93:
(8*8)+(7*6)+(6*4)+(5*0)+(4*6)+(3*8)+(2*9)+(1*3)=199
199 % 10 = 9
So 864068-93-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H8IN3/c10-9-3-1-8(2-4-9)5-13-7-11-6-12-13/h1-4,6-7H,5H2
