864075-95-6 Usage
General Description
3-(5-NITROPYRIDIN-2-YL)BENZOIC ACID is a chemical compound with the molecular formula C12H8N2O4. It is a nitro-containing aromatic compound that consists of a benzoic acid moiety linked to a 5-nitropyridin-2-yl group. This chemical is mainly used in the pharmaceutical industry as a building block for the synthesis of various drugs and active pharmaceutical ingredients. It is also used in organic synthesis as a starting material for the production of other compounds. 3-(5-NITROPYRIDIN-2-YL)BENZOIC ACID is known for its potential as an intermediate in the synthesis of bioactive molecules and has various potential applications in medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 864075-95-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,4,0,7 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 864075-95:
(8*8)+(7*6)+(6*4)+(5*0)+(4*7)+(3*5)+(2*9)+(1*5)=196
196 % 10 = 6
So 864075-95-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N2O4/c15-12(16)9-3-1-2-8(6-9)11-5-4-10(7-13-11)14(17)18/h1-7H,(H,15,16)
864075-95-6Relevant articles and documents
AMINO ACIDS
-
Page/Page column 50-51, (2008/06/13)
Compounds of formula (I): Z’ -CO-A-B-NH-Z (I) wherein: Z is H or an amino protecting group; Z’ is OH, a protected or activated hydroxyl group or C1; A is an optionally substituted C5-6 arylene group; and B is an optionally substituted C5-6 arylene group.
