864263-95-6 Usage
General Description
1-(2,4-Dichloro-phenyl)-cyclopropylamine is a chemical compound that contains a cyclopropylamine group attached to a phenyl ring with two chlorine atoms at positions 2 and 4. It is used in the pharmaceutical industry as a building block for the synthesis of various pharmaceutical drugs and as a research chemical in the study of molecular interactions. The presence of the cyclopropylamine group makes it a potential candidate for drug design due to its unique properties and potential pharmacological activity. Additionally, the presence of the phenyl ring and chlorine atoms provides opportunities for further chemical modifications to enhance its potency and selectivity for specific drug targets. Its molecular structure and chemical properties make it a valuable tool in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 864263-95-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,4,2,6 and 3 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 864263-95:
(8*8)+(7*6)+(6*4)+(5*2)+(4*6)+(3*3)+(2*9)+(1*5)=196
196 % 10 = 6
So 864263-95-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H9Cl2N/c10-6-1-2-7(8(11)5-6)9(12)3-4-9/h1-2,5H,3-4,12H2