86504-33-8 Usage
Uses
Used in Organic Synthesis:
2,3,4-triphenylcyclopent-2-ene-1,5-dione is utilized as a building block in organic synthesis for constructing more complex molecules. Its unique structure and reactivity contribute to the creation of a wide range of chemical entities.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2,3,4-triphenylcyclopent-2-ene-1,5-dione serves as an important reagent. Its properties make it instrumental in the development of new drugs, potentially leading to advancements in medicinal chemistry.
Used in Agrochemicals:
2,3,4-triphenylcyclopent-2-ene-1,5-dione is also employed in the agrochemical sector, where it is used as a component in the synthesis of various agrochemical products, contributing to the development of more effective and targeted agricultural solutions.
Used in Materials Chemistry:
2,3,4-triphenylcyclopent-2-ene-1,5-dione is used as a key intermediate in materials chemistry, where it aids in the synthesis of new materials with specific properties, such as improved conductivity, strength, or other desirable characteristics.
Used in Chemical Reaction Mechanism Studies:
Due to its structure and reactivity, 2,3,4-triphenylcyclopent-2-ene-1,5-dione is a valuable tool for researchers studying the mechanisms of various chemical reactions, providing insights that can lead to a better understanding of chemical processes and the development of new synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 86504-33-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,5,0 and 4 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 86504-33:
(7*8)+(6*6)+(5*5)+(4*0)+(3*4)+(2*3)+(1*3)=138
138 % 10 = 8
So 86504-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C23H16O2/c24-22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21(23(22)25)18-14-8-3-9-15-18/h1-15,20H