865449-53-2 Usage
Uses
Used in Pharmaceutical Research:
7-Fluoro-4-oxo-4H-chromene-2-carboxylic acid ethyl ester is used as a valuable target for drug development due to its potential biological activities, including anti-inflammatory, antioxidant, and antitumor properties. Its unique structure and functional groups contribute to its potential as a promising pharmaceutical candidate.
Used in Organic Synthesis:
In the field of organic synthesis, 7-Fluoro-4-oxo-4H-chromene-2-carboxylic acid ethyl ester is used as a valuable building block for the synthesis of various bioactive compounds. Its versatility in chemical reactions and modifications allows for the creation of a wide range of molecules with potential applications in different industries.
Used in Medicinal Chemistry Studies:
7-Fluoro-4-oxo-4H-chromene-2-carboxylic acid ethyl ester is used as a template structure for medicinal chemistry studies and drug design. Its unique properties and functional groups make it an ideal candidate for exploring new drug candidates and optimizing their therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 865449-53-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,5,4,4 and 9 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 865449-53:
(8*8)+(7*6)+(6*5)+(5*4)+(4*4)+(3*9)+(2*5)+(1*3)=212
212 % 10 = 2
So 865449-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H9FO4/c1-2-16-12(15)11-6-9(14)8-4-3-7(13)5-10(8)17-11/h3-6H,2H2,1H3
865449-53-2Relevant academic research and scientific papers
Antagonists of melanin concentrating hormone effects on the melanin concentrating hormone receptor
-
Page/Page column 41, (2010/02/14)
The present invention is directed to compounds of formula (I), which antagonize of the effects of melanin-concentrating hormone (MCH) through the melanin concentrating hormone receptor which is useful for the prevention or treatment of eating disorders, weight gain, obesity, abnormalities in reproduction and sexual behavior, thyroid hormone secretion, diuresis and water/electrolyte homeostasis, sensory processing, memory, sleeping, arousal, anxiety, depression, seizures, neurodegeneration and psychiatric disorders.
