86555-35-3 Usage
General Description
Malantide is a potent, selective, and reversible inhibitor of the enzyme angiotensin-converting enzyme (ACE), which plays a crucial role in the renin-angiotensin-aldosterone system. By inhibiting ACE, malantide effectively reduces the production of angiotensin II, a vasoconstrictor and stimulator of aldosterone release, leading to vasodilation and decreased sodium retention. This, in turn, results in reduced blood pressure and improved cardiac function, making malantide a promising candidate for the treatment of hypertension and heart failure. Its selectivity for ACE and reversible binding attributes to its potential as a therapeutic agent with fewer adverse effects compared to other ACE inhibitors. However, further research is needed to fully understand malantide's pharmacokinetics and potential side effects before it can be used clinically.
Check Digit Verification of cas no
The CAS Registry Mumber 86555-35-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,5,5 and 5 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 86555-35:
(7*8)+(6*6)+(5*5)+(4*5)+(3*5)+(2*3)+(1*5)=163
163 % 10 = 3
So 86555-35-3 is a valid CAS Registry Number.
InChI:InChI=1/C72H124N22O21/c1-8-39(6)56(70(114)115)92-62(106)45(18-10-12-28-74)85-63(107)48(32-37(2)3)88-66(110)52-20-15-31-94(52)69(113)47(25-26-54(100)101)87-64(108)49(33-41-21-23-42(98)24-22-41)89-67(111)55(38(4)5)91-65(109)51(36-96)83-53(99)34-82-59(103)50(35-95)90-61(105)46(19-14-30-81-72(78)79)84-60(104)44(17-9-11-27-73)86-68(112)57(40(7)97)93-58(102)43(75)16-13-29-80-71(76)77/h21-24,37-40,43-52,55-57,95-98H,8-20,25-36,73-75H2,1-7H3,(H,82,103)(H,83,99)(H,84,104)(H,85,107)(H,86,112)(H,87,108)(H,88,110)(H,89,111)(H,90,105)(H,91,109)(H,92,106)(H,93,102)(H,100,101)(H,114,115)(H4,76,77,80)(H4,78,79,81)/t39-,40+,43-,44-,45-,46-,47-,48-,49-,50-,51-,52-,55-,56-,57-/m0/s1