86604-43-5 Usage
Description
2-[1-(3-Methoxy-phenyl)-ethylidene]-malononitrile, also known as 3-Methoxyphenylpropenal malononitrile, is a chemical compound with the molecular formula C12H9NO2. It is a yellowish powder that features a malononitrile group attached to a 3-methoxyphenyl group through an ethylidene linker. This structure endows it with potential for diverse chemical reactivity and applications in medicinal chemistry and material science, particularly due to the presence of a nitrile group, which is useful for the preparation of various nitrogen-containing organic molecules.
Uses
Used in Organic Synthesis:
2-[1-(3-Methoxy-phenyl)-ethylidene]-malononitrile is used as a key intermediate in the synthesis of complex organic molecules. Its unique structure allows for versatile reactions that can lead to the formation of a wide range of nitrogen-containing compounds, which are essential in various chemical processes.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-[1-(3-Methoxy-phenyl)-ethylidene]-malononitrile serves as a valuable compound for the development of new drugs. Its chemical properties and reactivity make it a promising candidate for the creation of novel therapeutic agents, particularly those targeting specific biological pathways or mechanisms.
Used in Material Science:
2-[1-(3-METHOXY-PHENYL)-ETHYLIDENE]-MALONONITRILE's structural features also make it suitable for applications in material science. Its potential use in the development of new materials with unique properties, such as improved conductivity or enhanced stability, can contribute to advances in various technological fields.
Check Digit Verification of cas no
The CAS Registry Mumber 86604-43-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,6,0 and 4 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 86604-43:
(7*8)+(6*6)+(5*6)+(4*0)+(3*4)+(2*4)+(1*3)=145
145 % 10 = 5
So 86604-43-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H10N2O/c1-9(11(7-13)8-14)10-4-3-5-12(6-10)15-2/h3-6H,1-2H3
86604-43-5Relevant articles and documents
"on Water" Direct Catalytic Vinylogous Aldol Reaction of Silyl Glyoxylates
Pan, Hong,Han, Man-Yi,Li, Pinhua,Wang, Lei
, p. 14281 - 14290 (2019/11/03)
The unique reactivity of water in the direct catalytic vinylogous aldol reaction of silyl glyoxylates is reported. With the hydrogen-bonding networks from water, the unfavorable homogeneous reactions in organic solvents were severely suppressed, and the "
NOVEL COMPOUNDS
-
Page/Page column 30; 31, (2011/07/07)
The present invention relates to novel NADPH oxidase II inhibitors and their use in the treatment of diseases mediated by the NADPH oxidase II enzyme.
