86685-97-4 Usage
Uses
Used in Medicinal Chemistry:
3-m-tolyl-isoxazol-5-ylamine is used as a potential drug candidate for its pharmacological properties and bioavailability. It is considered for the development of new drugs aimed at treating a range of diseases and conditions, leveraging its chemical structure to target specific biological pathways.
Used in Agrochemicals:
In the agrochemical industry, 3-m-tolyl-isoxazol-5-ylamine is utilized for its potential applications in the development of pesticides, herbicides, or other crop protection agents. Its chemical properties may offer novel mechanisms for managing pests and diseases in agriculture.
Used in Chemical Synthesis:
3-m-tolyl-isoxazol-5-ylamine serves as a building block in chemical synthesis, contributing to the creation of more complex molecules with specific functions. Its reactivity and structural features make it a valuable component in the synthesis of advanced materials and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 86685-97-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,6,8 and 5 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 86685-97:
(7*8)+(6*6)+(5*6)+(4*8)+(3*5)+(2*9)+(1*7)=194
194 % 10 = 4
So 86685-97-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O/c1-7-3-2-4-8(5-7)9-6-10(11)13-12-9/h2-6H,11H2,1H3
