868-83-7 Usage
General Description
2-chloroacetohydrazide hydrochloride is a chemical compound that is used in various fields, including pharmaceuticals and agrochemicals. It is an intermediate in the synthesis of diverse functionalized hydrazide derivatives, which have potential therapeutic applications. 2-chloroacetohydrazide hydrochloride is a white crystalline solid that is soluble in water and ethanol. Its hydrochloride form enhances its stability and solubility in aqueous solutions, making it easier to handle and use in chemical reactions. Additionally, 2-chloroacetohydrazide hydrochloride is known for its antibacterial and antifungal properties, making it useful in the development of new antimicrobial agents. Overall, this chemical compound has versatile applications and is valuable in the synthesis of various biologically active molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 868-83-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,6 and 8 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 868-83:
(5*8)+(4*6)+(3*8)+(2*8)+(1*3)=107
107 % 10 = 7
So 868-83-7 is a valid CAS Registry Number.
InChI:InChI=1/C2H5ClN2O.ClH/c3-1-2(6)5-4;/h1,4H2,(H,5,6);1H
