868271-13-0 Usage
Uses
Used in Pharmaceutical Research and Development:
1,2-Benzisoxazol-3-amine, 5-fluorois used as a building block in the synthesis of pharmaceuticals for its potential to enhance the pharmacokinetic properties of drug molecules. Its fluorinated nature can improve the drug's bioavailability, metabolic stability, and target binding affinity.
Used in Agrochemical Research and Development:
1,2-Benzisoxazol-3-amine, 5-fluorois used as a building block in the development of agrochemicals, such as pesticides and herbicides. Its unique structure and properties can contribute to the design of novel and effective agrochemicals with improved performance and selectivity.
Used in Organic Synthesis:
1,2-Benzisoxazol-3-amine, 5-fluorois used as a reagent in organic synthesis for introducing the 5-fluoro-substituent onto different molecules. This can lead to the formation of new compounds with altered properties and potential applications in various fields, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 868271-13-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,8,2,7 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 868271-13:
(8*8)+(7*6)+(6*8)+(5*2)+(4*7)+(3*1)+(2*1)+(1*3)=200
200 % 10 = 0
So 868271-13-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H5FN2O/c8-4-1-2-6-5(3-4)7(9)10-11-6/h1-3H,(H2,9,10)
