86867-68-7 Usage
General Description
2-(difluoromethoxy)phenylacetic acid is a chemical compound with the molecular formula C9H9F2O3. It is a phenylacetic acid derivative with two fluorine atoms and a methoxy group attached to the phenyl ring. 2-(difluoromethoxy)phenylacetic acid has potential applications in medicinal chemistry as it has been investigated for its anti-inflammatory and analgesic properties. Additionally, it has also been studied for its potential use in the treatment of central nervous system disorders. The presence of the difluoromethoxy group in its structure may contribute to its unique pharmacological properties, making it a potentially valuable compound in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 86867-68-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,8,6 and 7 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 86867-68:
(7*8)+(6*6)+(5*8)+(4*6)+(3*7)+(2*6)+(1*8)=197
197 % 10 = 7
So 86867-68-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8F2O3/c10-9(11)14-7-4-2-1-3-6(7)5-8(12)13/h1-4,9H,5H2,(H,12,13)
