868948-13-4 Usage
Uses
Used in Pharmaceutical Industry:
Pentanamide, N-(6-chloro-3-pyridazinyl)is used as a building block for the synthesis of new drugs and pharmaceutical ingredients. Its unique chemical structure and reactivity make it a promising candidate for the development of innovative therapeutic agents.
Used in Drug Discovery and Development:
Due to its potential antifungal and antibacterial properties, Pentanamide, N-(6-chloro-3-pyridazinyl)is used as a target for drug discovery and development. Its ability to selectively interact with biological targets and exhibit antimicrobial activity positions it as a valuable asset in the search for new treatments for various infections and diseases.
Used in Chemical Research:
Pentanamide, N-(6-chloro-3-pyridazinyl)is also used in chemical research for its specific properties and reactivity. It serves as a valuable tool for studying selective chemical reactions and understanding the underlying mechanisms involved in these processes. This knowledge can contribute to the advancement of synthetic chemistry and the development of new chemical methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 868948-13-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,8,9,4 and 8 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 868948-13:
(8*8)+(7*6)+(6*8)+(5*9)+(4*4)+(3*8)+(2*1)+(1*3)=244
244 % 10 = 4
So 868948-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H12ClN3O/c1-2-3-4-9(14)11-8-6-5-7(10)12-13-8/h5-6H,2-4H2,1H3,(H,11,13,14)
