869-25-0 Usage
Uses
Used in Organic Synthesis:
2-CHLORO-N,N-DIETHYLPROPANAMINE HYDROCHLORIDE is used as a reagent in organic synthesis for its ability to facilitate various chemical reactions, contributing to the formation of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-CHLORO-N,N-DIETHYLPROPANAMINE HYDROCHLORIDE is used as a building block for the preparation of various pharmaceuticals. Its unique chemical structure allows it to be a key component in the development of new drugs.
Used in Agrochemical Industry:
Similarly, in the agrochemical industry, 2-CHLORO-N,N-DIETHYLPROPANAMINE HYDROCHLORIDE is utilized as a building block for the preparation of agrochemicals, playing a crucial role in the synthesis of compounds that contribute to agricultural productivity and pest control.
Check Digit Verification of cas no
The CAS Registry Mumber 869-25-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,6 and 9 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 869-25:
(5*8)+(4*6)+(3*9)+(2*2)+(1*5)=100
100 % 10 = 0
So 869-25-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H17NO.ClH/c1-4-8(5-2)6-7(3)9;/h7,9H,4-6H2,1-3H3;1H
