86932-94-7 Usage
Uses
Used in Pharmaceutical Industry:
1H-Benzimidazole,2-(tetrahydro-2-furanyl)-(9CI) is used as a building block for the synthesis of pharmaceuticals due to its potential biological activities, such as anti-cancer, anti-inflammatory, and anti-viral properties. Its unique structure allows it to be a key component in the development of new drugs targeting various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical industry, 1H-Benzimidazole,2-(tetrahydro-2-furanyl)-(9CI) serves as a building block for the synthesis of agrochemicals, contributing to the development of new pesticides, herbicides, and other agricultural products that can improve crop yield and protect plants from diseases and pests.
Used in Coordination Chemistry:
1H-Benzimidazole,2-(tetrahydro-2-furanyl)-(9CI) is used as a ligand in coordination chemistry, playing a crucial role in the formation of coordination compounds. These compounds have various applications, including catalysis, materials science, and the development of new technologies.
Used in Organic Synthesis:
As an intermediate in organic synthesis, 1H-Benzimidazole,2-(tetrahydro-2-furanyl)-(9CI) is utilized for the production of various compounds. Its unique structure and properties make it a valuable component in the synthesis of complex organic molecules, which can be used in a wide range of applications, from pharmaceuticals to specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 86932-94-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,9,3 and 2 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 86932-94:
(7*8)+(6*6)+(5*9)+(4*3)+(3*2)+(2*9)+(1*4)=177
177 % 10 = 7
So 86932-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O/c1-2-5-9-8(4-1)12-11(13-9)10-6-3-7-14-10/h1-2,4-5,10H,3,6-7H2,(H,12,13)
