869488-99-3 Usage
Uses
Used in Pharmaceutical Industry:
1-BENZHYDRYL-3-FLUORO-AZETIDINE HYDROCHLORIDE is used as a building block for the creation of new drugs and drug targets due to its unique chemical structure and reactivity. Its potential applications in the pharmaceutical industry include the development of novel therapeutic agents and the enhancement of existing drug formulations.
Used in Organic Synthesis:
1-BENZHYDRYL-3-FLUORO-AZETIDINE HYDROCHLORIDE is used as a key intermediate in the synthesis of various organic compounds. Its specific chemical properties and reactivity make it a valuable component in the preparation of complex organic molecules, contributing to the advancement of organic chemistry and the development of new materials and compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 869488-99-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,9,4,8 and 8 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 869488-99:
(8*8)+(7*6)+(6*9)+(5*4)+(4*8)+(3*8)+(2*9)+(1*9)=263
263 % 10 = 3
So 869488-99-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H16FN.ClH/c17-15-11-18(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14;/h1-10,15-16H,11-12H2;1H
869488-99-3Relevant academic research and scientific papers
Therapeutic compounds
-
Page/Page column 12, (2008/06/13)
The invention provides compounds of formula (I), prodrugs and stereoisomers thereof, and the pharmaceutically acceptable salts of the compounds, prodrugs, and stereoisomers, wherein R1, R2, R3, HET, n, Q, X, Y, and Z are as described herein; compositions thereof; and uses thereof in treating diabetic complications including diabetic neuropathy, diabetic nephropathy, diabetic microangiopathy, and the like.
