86984-27-2 Usage
Uses
Used in Organic Synthesis:
6-Chloro-7-methylquinoline is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for further functionalization and modification, making it a valuable building block for the development of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 6-chloro-7-methylquinoline is used as a starting material for the synthesis of various drug candidates. Its presence in the molecular structure can impart specific biological activities, such as antimicrobial, anti-inflammatory, or anticancer properties, depending on the final compound's design and synthesis.
Used in Agrochemical Industry:
6-Chloro-7-methylquinoline also finds applications in the agrochemical industry, where it serves as a precursor for the development of new pesticides and herbicides. Its unique chemical properties can contribute to the creation of more effective and targeted agrochemicals.
Used in Dye and Pigment Industry:
In the dye and pigment industry, 6-chloro-7-methylquinoline can be used as a building block for the synthesis of novel dyes and pigments. Its ability to form stable complexes with various metal ions can lead to the development of new colorants with improved properties, such as enhanced color strength, stability, and resistance to fading.
Used in Material Science:
6-Chloro-7-methylquinoline can also be employed in material science for the development of new materials with specific properties. For example, it can be used in the synthesis of organic semiconductors, which have potential applications in organic light-emitting diodes (OLEDs), organic photovoltaics (OPVs), and other optoelectronic devices.
Check Digit Verification of cas no
The CAS Registry Mumber 86984-27-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,9,8 and 4 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 86984-27:
(7*8)+(6*6)+(5*9)+(4*8)+(3*4)+(2*2)+(1*7)=192
192 % 10 = 2
So 86984-27-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H8ClN/c1-7-5-10-8(6-9(7)11)3-2-4-12-10/h2-6H,1H3
