869901-12-2 Usage
General Description
(1-Methyl-5-phenyl-1H-pyrazol-3-yl)methylamine is a chemical compound with a pyrazole ring and a methylamine group. It is a small organic molecule with the molecular formula C10H12N2 and a molecular weight of 160.21 g/mol. This chemical is commonly used in the pharmaceutical and agrochemical industries as a building block for the synthesis of various biologically active compounds. It can also act as a ligand in the coordination chemistry of transition metal complexes. Additionally, (1-Methyl-5-phenyl-1H-pyrazol-3-yl)methylamine has potential applications in the field of materials science, as it can be incorporated into organic materials to modify their properties. Overall, this compound has versatility and potential for various industrial and research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 869901-12-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,9,9,0 and 1 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 869901-12:
(8*8)+(7*6)+(6*9)+(5*9)+(4*0)+(3*1)+(2*1)+(1*2)=212
212 % 10 = 2
So 869901-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H13N3/c1-14-11(7-10(8-12)13-14)9-5-3-2-4-6-9/h2-7H,8,12H2,1H3