869950-50-5 Usage
Uses
Used in Pharmaceutical Research and Development:
3-(((5-METHYLTHIEN-2-YL)METHYL)AMINO)BENZOIC ACID is used as a chemical intermediate for the synthesis of new drugs. Its unique structure and properties make it a valuable compound for exploring potential therapeutic applications and developing innovative pharmaceuticals.
Used in Medicinal Chemistry:
3-(((5-METHYLTHIEN-2-YL)METHYL)AMINO)BENZOIC ACID is utilized as a building block in the design and synthesis of novel compounds with potential medicinal properties. Its versatile chemical structure allows for further functionalization and optimization to enhance its pharmacological activity and selectivity.
Used in Drug Discovery:
3-(((5-METHYLTHIEN-2-YL)METHYL)AMINO)BENZOIC ACID serves as a starting point for drug discovery efforts, where its structure can be modified to identify new lead compounds with improved potency, safety, and pharmacokinetic profiles. 3-(((5-METHYLTHIEN-2-YL)METHYL)AMINO)BENZOIC ACID's potential makes it a valuable asset in the search for new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 869950-50-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,9,9,5 and 0 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 869950-50:
(8*8)+(7*6)+(6*9)+(5*9)+(4*5)+(3*0)+(2*5)+(1*0)=235
235 % 10 = 5
So 869950-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO2S/c1-9-5-6-12(17-9)8-14-11-4-2-3-10(7-11)13(15)16/h2-7,14H,8H2,1H3,(H,15,16)
