870718-01-7 Usage
Uses
Used in Pharmaceutical Industry:
3-BROMO-2-ISOPROPOXY-5-METHYLPHENYLBORO& is used as a key intermediate in the synthesis of pharmaceutical compounds for its ability to facilitate the formation of complex organic molecules through various coupling reactions. Its unique reactivity allows for the creation of new chemical entities with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 3-BROMO-2-ISOPROPOXY-5-METHYLPHENYLBORO& is used as a building block for the development of agrochemicals, contributing to the synthesis of new compounds with potential applications in crop protection and pest control.
Used in Materials Science:
3-BROMO-2-ISOPROPOXY-5-METHYLPHENYLBORO& is utilized as a reagent in materials science for the synthesis of novel materials with specific properties. Its involvement in various coupling reactions enables the creation of materials with potential applications in different fields, such as electronics, energy storage, and advanced materials development.
Overall, 3-BROMO-2-ISOPROPOXY-5-METHYLPHENYLBORO& plays a significant role in various industries due to its versatility and reactivity, making it an essential component in the synthesis of complex organic molecules and the development of new chemical entities with potential applications in therapeutics, agriculture, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 870718-01-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,7,1 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 870718-01:
(8*8)+(7*7)+(6*0)+(5*7)+(4*1)+(3*8)+(2*0)+(1*1)=177
177 % 10 = 7
So 870718-01-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BBrO3/c1-6(2)15-10-8(11(13)14)4-7(3)5-9(10)12/h4-6,13-14H,1-3H3
