870718-03-9 Usage
Uses
Used in Organic Synthesis:
3-BROMO-2-BUTOXY-5-METHYLPHENYLBORONIC & is employed as a synthetic intermediate for the preparation of complex organic molecules. Its unique structure allows for versatile reactions, facilitating the construction of a variety of chemical entities with potential applications in different fields.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-BROMO-2-BUTOXY-5-METHYLPHENYLBORONIC & is utilized as a key component in the development of new drugs. Its reactivity and structural features make it suitable for the synthesis of biologically active compounds, contributing to the advancement of medicinal chemistry and the discovery of novel therapeutic agents.
Used in Medicinal Chemistry:
3-BROMO-2-BUTOXY-5-METHYLPHENYLBORONIC & is applied as a valuable tool in medicinal chemistry for the design and synthesis of potential drug candidates. Its properties enable researchers to explore new chemical space and optimize the pharmacological properties of lead compounds, thereby enhancing the chances of developing effective treatments for various diseases.
Used in Drug Discovery:
3-BROMO-2-BUTOXY-5-METHYLPHENYLBORONIC & plays a crucial role in drug discovery processes, where it is used to construct and modify molecular frameworks of potential pharmaceuticals. Its incorporation into drug candidates can lead to improved pharmacokinetic and pharmacodynamic profiles, ultimately contributing to the development of safer and more effective medications.
Check Digit Verification of cas no
The CAS Registry Mumber 870718-03-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,7,1 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 870718-03:
(8*8)+(7*7)+(6*0)+(5*7)+(4*1)+(3*8)+(2*0)+(1*3)=179
179 % 10 = 9
So 870718-03-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H16BBrO3/c1-3-4-5-16-11-9(12(14)15)6-8(2)7-10(11)13/h6-7,14-15H,3-5H2,1-2H3
