870718-04-0 Usage
Uses
Used in Organic Chemistry:
3-Bromo-2-Isopropoxyphenylboronic Acid is used as a key intermediate in the synthesis of complex organic molecules for various applications. Its role in the Suzuki coupling procedure allows for the formation of carbon-carbon bonds, which is fundamental in creating a wide range of organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Bromo-2-Isopropoxyphenylboronic Acid is used as a building block for the development of new drugs. Its ability to form carbon-carbon bonds through the Suzuki coupling process enables the creation of diverse molecular structures, which can be further modified to produce potential therapeutic agents.
Used in Material Science:
3-Bromo-2-Isopropoxyphenylboronic Acid is also utilized in material science for the synthesis of advanced materials with specific properties. The formation of carbon-carbon bonds in its structure can lead to the development of new materials with improved characteristics, such as enhanced stability, reactivity, or selectivity, which can be applied in various fields, including electronics, energy storage, and catalysis.
Check Digit Verification of cas no
The CAS Registry Mumber 870718-04-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,7,1 and 8 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 870718-04:
(8*8)+(7*7)+(6*0)+(5*7)+(4*1)+(3*8)+(2*0)+(1*4)=180
180 % 10 = 0
So 870718-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BBrO3/c1-6(2)14-9-7(10(12)13)4-3-5-8(9)11/h3-6,12-13H,1-2H3
