870718-05-1 Usage
Uses
Used in Organic Synthesis:
3-Ethylthiophenylboronic acid is used as a building block in organic synthesis for the formation of carbon-carbon and carbon-heteroatom bonds. Its unique reactivity allows for the creation of complex organic molecules, which are essential in various chemical processes.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 3-Ethylthiophenylboronic acid is utilized in the development of new drugs. Its ability to form carbon-carbon and carbon-heteroatom bonds makes it a versatile component in the synthesis of bioactive molecules with potential therapeutic applications.
Used in Agrochemical Development:
3-Ethylthiophenylboronic acid is also employed in the development of agrochemicals. Its reactivity and ability to form various chemical bonds contribute to the creation of new compounds with potential applications in agriculture, such as pesticides and herbicides.
Used in Materials Science:
In the field of materials science, 3-Ethylthiophenylboronic acid is used to develop new materials with specific properties. Its unique reactivity allows for the synthesis of novel materials with potential applications in various industries, including electronics, energy, and nanotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 870718-05-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,7,1 and 8 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 870718-05:
(8*8)+(7*7)+(6*0)+(5*7)+(4*1)+(3*8)+(2*0)+(1*5)=181
181 % 10 = 1
So 870718-05-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H11BO2S/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6,10-11H,2H2,1H3
