871013-29-5 Usage
Uses
Used in Pharmaceutical Industry:
Thieno[3,2-d]pyrimidine-7-methanamine (9CI) is used as a potential pharmaceutical agent for its diverse biological activities, particularly for its anti-microbial and anti-cancer properties. Its unique chemical structure allows it to interact with various biological targets, making it a promising candidate for the development of new therapeutics.
Used in Research and Development:
In the field of chemical research, Thieno[3,2-d]pyrimidine-7-methanamine (9CI) serves as a key compound for studying the structure-activity relationships of thieno[3,2-d]pyrimidines. This understanding can lead to the design and synthesis of novel compounds with improved pharmacological properties and therapeutic potential.
Used in Drug Discovery:
Thieno[3,2-d]pyrimidine-7-methanamine (9CI) is utilized in drug discovery processes to identify new lead compounds with potential therapeutic applications. Its presence in the Ninth Collective Index of the Chemical Abstracts Service facilitates its accessibility for researchers and pharmaceutical companies seeking to explore its potential in various disease treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 871013-29-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,0,1 and 3 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 871013-29:
(8*8)+(7*7)+(6*1)+(5*0)+(4*1)+(3*3)+(2*2)+(1*9)=145
145 % 10 = 5
So 871013-29-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3S/c8-1-5-3-11-6-2-9-4-10-7(5)6/h2-4H,1,8H2
