871125-69-8 Usage
Uses
Used in Pharmaceutical Synthesis:
3-Ethoxy-2,4,6-trifluorophenylboronic acid is used as a reagent in the synthesis of pharmaceuticals for its ability to form carbon-carbon and carbon-heteroatom bonds. This property is crucial in the development of new drugs and the modification of existing ones to improve their efficacy and safety.
Used in Agrochemical Synthesis:
In the agrochemical industry, 3-ethoxy-2,4,6-trifluorophenylboronic acid is used as a reagent in the synthesis of various agrochemicals. Its ability to form carbon-carbon and carbon-heteroatom bonds is essential in creating new pesticides, herbicides, and other agricultural chemicals that can effectively protect crops and enhance agricultural productivity.
Used in Organic Synthesis:
3-Ethoxy-2,4,6-trifluorophenylboronic acid is used as a versatile reagent in organic synthesis across various industries. Its unique structure allows for the formation of carbon-carbon and carbon-heteroatom bonds, which is crucial in the synthesis of complex organic molecules for a wide range of applications, including materials science, chemical research, and the development of new compounds with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 871125-69-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,1,2 and 5 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 871125-69:
(8*8)+(7*7)+(6*1)+(5*1)+(4*2)+(3*5)+(2*6)+(1*9)=168
168 % 10 = 8
So 871125-69-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BF3O3/c1-2-15-8-5(11)3-4(10)6(7(8)12)9(13)14/h3,13-14H,2H2,1H3
