871125-79-0 Usage
Uses
Used in Organic Synthesis:
3-FORMYL-5-ISOPROPOXYPHENYLBORONIC ACID is used as a reagent in organic synthesis for its ability to facilitate the formation of carbon-carbon bonds. Its application is crucial in the creation of a variety of complex molecular structures that are otherwise difficult to synthesize.
Used in the Production of Bicyclic Compounds:
In the field of synthetic organic chemistry, 3-FORMYL-5-ISOPROPOXYPHENYLBORONIC ACID is utilized as a key intermediate in the synthesis of bicyclic compounds. Its unique structural features and reactivity allow for the construction of these multi-ring systems, which are important in various chemical and pharmaceutical applications.
Used in Pharmaceutical Development:
3-FORMYL-5-ISOPROPOXYPHENYLBORONIC ACID is employed as a building block in the development of pharmaceuticals. Its versatility in organic synthesis and ability to form complex molecular architectures make it a valuable component in the design and synthesis of novel drug candidates.
Used in Material Science:
This boronic acid derivative is also used in material science for the development of new materials with specific properties. Its reactivity and structural characteristics contribute to the creation of advanced materials with applications in various industries, including electronics, coatings, and polymers.
Used in Research and Development:
3-FORMYL-5-ISOPROPOXYPHENYLBORONIC ACID is utilized in research and development settings to explore new synthetic pathways and methodologies. Its unique properties and reactivity provide a platform for scientists to investigate novel chemical reactions and mechanisms, potentially leading to the discovery of new compounds and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 871125-79-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,1,2 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 871125-79:
(8*8)+(7*7)+(6*1)+(5*1)+(4*2)+(3*5)+(2*7)+(1*9)=170
170 % 10 = 0
So 871125-79-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BO4/c1-7(2)15-10-4-8(6-12)3-9(5-10)11(13)14/h3-7,13-14H,1-2H3
