871125-82-5 Usage
Uses
Used in Organic Synthesis:
4-(4'-Fluorobenzyloxy)phenylboronic acid is used as a reagent in the Suzuki-Miyaura cross-coupling reaction, a widely used method in organic chemistry for forming carbon-carbon bonds. This reaction allows for the formation of various organic compounds, making it a valuable tool in the synthesis of pharmaceuticals, agrochemicals, and other organic molecules.
Used in Pharmaceutical Industry:
4-(4'-Fluorobenzyloxy)phenylboronic acid is used as a pharmaceutical intermediate, contributing to the development of new drugs and therapeutic agents. Its unique structure and reactivity make it a promising candidate for the synthesis of bioactive compounds with potential applications in medicine.
Used in Material Science:
4-(4'-Fluorobenzyloxy)phenylboronic acid has shown potential in the development of new materials, such as polymers and coatings, due to its ability to form stable bonds and its compatibility with various organic solvents. This makes it a valuable component in the creation of advanced materials with specific properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 871125-82-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,1,2 and 5 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 871125-82:
(8*8)+(7*7)+(6*1)+(5*1)+(4*2)+(3*5)+(2*8)+(1*2)=165
165 % 10 = 5
So 871125-82-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H12BFO3/c15-12-5-1-10(2-6-12)9-18-13-7-3-11(4-8-13)14(16)17/h1-8,16-17H,9H2
