871126-19-1 Usage
Description
4-Butoxy-2,3,5,6-tetrafluorobenzenboronic acid is a boronic acid derivative characterized by a molecular formula of C10H10BF4O3. It features a benzene ring with a butoxy group and four fluorine atoms, offering unique structural properties that make it a valuable compound in the realm of organic synthesis and chemical research.
Uses
Used in Pharmaceutical Development:
4-Butoxy-2,3,5,6-tetrafluorobenzenboronic acid is used as a building block in the development of pharmaceuticals for its ability to contribute to the creation of various organic molecules with potential therapeutic applications.
Used in Agrochemical Development:
In the agrochemical industry, 4-Butoxy-2,3,5,6-tetrafluorobenzenboronic acid is utilized as a key component in the synthesis of new agrochemicals, leveraging its structural properties to enhance crop protection and yield.
Used in Medicinal Chemistry:
4-Butoxy-2,3,5,6-tetrafluorobenzenboronic acid is employed as a reagent in medicinal chemistry, facilitating the synthesis of complex organic molecules that can be further explored for their pharmacological properties and potential use in treating various diseases.
Used in Materials Science:
4-BUTOXY-2,3,5,6-TETRAFLUOROBENZENEBORONIC ACID is also used in materials science as a reagent for synthesizing advanced materials with specific properties, such as those with unique electronic, optical, or mechanical characteristics, which can be applied in various high-tech industries.
Check Digit Verification of cas no
The CAS Registry Mumber 871126-19-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,1,2 and 6 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 871126-19:
(8*8)+(7*7)+(6*1)+(5*1)+(4*2)+(3*6)+(2*1)+(1*9)=161
161 % 10 = 1
So 871126-19-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BF4O3/c1-2-3-4-18-10-8(14)6(12)5(11(16)17)7(13)9(10)15/h16-17H,2-4H2,1H3
