871126-28-2 Usage
General Description
4-Isopropoxy-2,3,5,6-tetrafluorobenzenboronic acid is a chemical compound used as a reagent in organic synthesis. It is a boronic acid derivative, which means it contains a boron atom attached to a carbon atom with hydroxyl and fluoro groups. 4-ISOPROPOXY-2,3,5,6-TETRAFLUOROBENZENEBORONIC ACID is often used in the Suzuki-Miyaura coupling reaction, which is a versatile method for the synthesis of carbon-carbon bonds. It can also be utilized in the production of pharmaceuticals, agrochemicals, and materials due to its ability to form stable covalent bonds with organic molecules. Additionally, its unique structure and properties make it valuable in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 871126-28-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,1,2 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 871126-28:
(8*8)+(7*7)+(6*1)+(5*1)+(4*2)+(3*6)+(2*2)+(1*8)=162
162 % 10 = 2
So 871126-28-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H9BF4O3/c1-3(2)17-9-7(13)5(11)4(10(15)16)6(12)8(9)14/h3,15-16H,1-2H3