871266-83-0 Usage
Description
(7-CHLOROTHIAZOLO[5,4-D]PYRIMIDIN-2-YL)-(4-NITROPHENYL)AMINE is a heterocyclic organic compound characterized by its molecular formula C11H6ClN5O2. It features a thiazole ring and a pyrimidine ring, along with a chloro group and a nitro group attached to a phenyl ring. (7-CHLOROTHIAZOLO[5,4-D]PYRIMIDIN-2-YL)-(4-NITROPHENYL)AMINE may hold potential in medicinal chemistry and drug discovery due to its unique structural features and possible biological activities. Further research and studies are necessary to fully comprehend its potential and possible applications across various fields.
Uses
Used in Medicinal Chemistry:
(7-CHLOROTHIAZOLO[5,4-D]PYRIMIDIN-2-YL)-(4-NITROPHENYL)AMINE is used as a compound in medicinal chemistry for its potential to contribute to the development of new drugs. Its unique structure may allow for interactions with biological targets, potentially leading to the creation of novel therapeutic agents.
Used in Drug Discovery:
In the field of drug discovery, (7-CHLOROTHIAZOLO[5,4-D]PYRIMIDIN-2-YL)-(4-NITROPHENYL)AMINE is used as a starting point for the design and synthesis of new pharmaceuticals. Its structural features may provide a foundation for the development of compounds with specific biological activities, targeting various diseases and conditions.
Used in Pharmaceutical Research:
(7-CHLOROTHIAZOLO[5,4-D]PYRIMIDIN-2-YL)-(4-NITROPHENYL)AMINE is used as a research tool in the pharmaceutical industry to study its interactions with various biological targets. Understanding these interactions can help in the development of more effective and targeted treatments for a range of medical conditions.
Used in Chemical Synthesis:
As a heterocyclic organic compound, (7-CHLOROTHIAZOLO[5,4-D]PYRIMIDIN-2-YL)-(4-NITROPHENYL)AMINE is used in chemical synthesis for the creation of other complex molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 871266-83-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,2,6 and 6 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 871266-83:
(8*8)+(7*7)+(6*1)+(5*2)+(4*6)+(3*6)+(2*8)+(1*3)=190
190 % 10 = 0
So 871266-83-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H6ClN5O2S/c12-9-8-10(14-5-13-9)20-11(16-8)15-6-1-3-7(4-2-6)17(18)19/h1-5H,(H,15,16)