871269-05-5 Usage
Uses
Used in Pharmaceutical Industry:
2-ETHOXY-5-(N,N-DIISOPROPYL)AMINOPYRIDINE is used as a reactant in the synthesis of pharmaceutical drugs due to its ability to contribute to the formation of complex molecular structures that can have therapeutic effects.
Used in Organic Chemistry:
In the realm of organic chemistry, 2-ETHOXY-5-(N,N-DIISOPROPYL)AMINOPYRIDINE is utilized as an important building block, facilitating the creation of a wide range of organic compounds through its reactivity and structural properties.
Used as a Precursor in Agrochemical Synthesis:
2-ETHOXY-5-(N,N-DIISOPROPYL)AMINOPYRIDINE is used as a precursor in the synthesis of agrochemicals, playing a crucial role in the development of compounds that can protect crops and enhance agricultural productivity.
Used in Fine Chemicals Synthesis:
2-ETHOXY-5-(N,N-DIISOPROPYL)AMINOPYRIDINE is also employed as a precursor in the synthesis of fine chemicals, which are high-purity chemicals used in various applications, including the fragrance, flavor, and pharmaceutical industries, where the precise structure and properties of the compound are essential for the desired effects.
Check Digit Verification of cas no
The CAS Registry Mumber 871269-05-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,2,6 and 9 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 871269-05:
(8*8)+(7*7)+(6*1)+(5*2)+(4*6)+(3*9)+(2*0)+(1*5)=185
185 % 10 = 5
So 871269-05-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H22N2O/c1-6-16-13-8-7-12(9-14-13)15(10(2)3)11(4)5/h7-11H,6H2,1-5H3
