87129-38-2 Usage
Uses
Used in the Fragrance Industry:
ALLYL 2-BROMOPROPIONATE is used as a key intermediate for the production of fragrances, contributing to the creation of complex and appealing scents in various consumer products.
Used in the Flavor Industry:
In the flavor industry, ALLYL 2-BROMOPROPIONATE is utilized as an intermediate to develop unique taste profiles for food and beverage products, enhancing the sensory experience.
Used in the Pharmaceutical Industry:
ALLYL 2-BROMOPROPIONATE is used as a crucial intermediate in the synthesis of pharmaceutical compounds, playing a significant role in the development of new medications.
Used in Organic Synthesis:
As a reagent in organic synthesis, ALLYL 2-BROMOPROPIONATE is used for the formation of carbon-carbon and carbon-heteroatom bonds, facilitating the creation of diverse organic molecules for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 87129-38-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,1,2 and 9 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 87129-38:
(7*8)+(6*7)+(5*1)+(4*2)+(3*9)+(2*3)+(1*8)=152
152 % 10 = 2
So 87129-38-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H9BrO2/c1-3-4-9-6(8)5(2)7/h3,5H,1,4H2,2H3
