871329-53-2 Usage
Uses
Used in Organic Synthesis:
[5-(Methoxycarbonyl)pyridin-3-yl]boronic acid is used as a building block for the synthesis of various pharmaceuticals, agrochemicals, and materials. Its unique structure and reactivity contribute to the development of new compounds with potential applications in these fields.
Used in Cross-Coupling Reactions:
As a reagent, [5-(Methoxycarbonyl)pyridin-3-yl]boronic acid is utilized in cross-coupling reactions, particularly Suzuki-Miyaura coupling, to form carbon-carbon bonds. This reaction is widely used in the synthesis of complex organic molecules and plays a significant role in the development of new chemical entities.
Used in Medicinal Chemistry Research:
[5-(Methoxycarbonyl)pyridin-3-yl]boronic acid is employed in medicinal chemistry research for the design and synthesis of novel bioactive compounds. Its unique chemical properties allow for the exploration of new therapeutic agents and the optimization of existing drug candidates.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, [5-(Methoxycarbonyl)pyridin-3-yl]boronic acid is used as a key intermediate in the synthesis of various drug molecules. Its versatility and reactivity make it an essential component in the development of new medications with improved efficacy and safety profiles.
Used in Agrochemical Industry:
[5-(Methoxycarbonyl)pyridin-3-yl]boronic acid is also used in the agrochemical industry for the synthesis of pesticides and other agrochemical products. Its application in this field contributes to the development of more effective and environmentally friendly solutions for crop protection and management.
Check Digit Verification of cas no
The CAS Registry Mumber 871329-53-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,2 and 9 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 871329-53:
(8*8)+(7*7)+(6*1)+(5*3)+(4*2)+(3*9)+(2*5)+(1*3)=182
182 % 10 = 2
So 871329-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8BNO4/c1-13-7(10)5-2-6(8(11)12)4-9-3-5/h2-4,11-12H,1H3