871329-56-5 Usage
Uses
Used in Organic Synthesis:
2-Ethoxymethylphenylboronic acid is used as a building block in organic synthesis for the formation of carbon-carbon and carbon-oxygen bonds. Its reactivity with unsaturated compounds and its ability to form stable complexes with various substrates make it a versatile reagent in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Ethoxymethylphenylboronic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and reactivity enable the development of new drugs with improved therapeutic properties.
Used in Material Science:
2-Ethoxymethylphenylboronic acid is also used in material science for the development of new materials with specific properties. Its ability to form stable complexes with various substrates allows for the creation of materials with tailored characteristics for specific applications.
Used in Research and Development:
In research and development, 2-Ethoxymethylphenylboronic acid is used as a reagent to explore new chemical reactions and mechanisms. Its unique properties and reactivity provide researchers with valuable insights into the behavior of boronic acid derivatives and their potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 871329-56-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,2 and 9 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 871329-56:
(8*8)+(7*7)+(6*1)+(5*3)+(4*2)+(3*9)+(2*5)+(1*6)=185
185 % 10 = 5
So 871329-56-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H13BO3/c1-2-13-7-8-5-3-4-6-9(8)10(11)12/h3-6,11-12H,2,7H2,1H3
